C13H14ClNO5 — CID 43170498
4-chloro-2-[(4-ethoxy-4-oxobutanoyl)amino]benzoic acid (PubChem CID 43170498) has the molecular formula C13H14ClNO5 and a molecular weight of 299.71 g/mol. Its IUPAC name is 4-chloro-2-[(4-ethoxy-4-oxobutanoyl)amino]benzoic acid.
| Compound Name | 4-chloro-2-[(4-ethoxy-4-oxobutanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 43170498 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-chloro-2-[(4-ethoxy-4-oxobutanoyl)amino]benzoic acid |
| SMILES | CCOC(=O)CCC(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C13H14ClNO5/c1-2-20-12(17)6-5-11(16)15-10-7-8(14)3-4-9(10)13(18)19/h3-4,7H,2,5-6H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | XYFMUVAWQRRLIP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |