C11H12ClNO6S — CID 61457059
4-chloro-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]benzoic acid (PubChem CID 61457059) has the molecular formula C11H12ClNO6S and a molecular weight of 321.74 g/mol. Its IUPAC name is 4-chloro-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]benzoic acid.
| Compound Name | 4-chloro-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 61457059 |
| Molecular Formula | C11H12ClNO6S |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 4-chloro-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]benzoic acid |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H12ClNO6S/c1-2-19-10(14)6-20(17,18)13-9-5-7(12)3-4-8(9)11(15)16/h3-5,13H,2,6H2,1H3,(H,15,16) |
| InChIKey | BNWOLPFBKWOEFP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |