C10H10ClNO6S — CID 43361877
2-[(5-chloro-2-methoxycarbonylphenyl)sulfamoyl]acetic acid (PubChem CID 43361877) has the molecular formula C10H10ClNO6S and a molecular weight of 307.71 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxycarbonylphenyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(5-chloro-2-methoxycarbonylphenyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43361877 |
| Molecular Formula | C10H10ClNO6S |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-[(5-chloro-2-methoxycarbonylphenyl)sulfamoyl]acetic acid |
| SMILES | COC(=O)c1ccc(Cl)cc1NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C10H10ClNO6S/c1-18-10(15)7-3-2-6(11)4-8(7)12-19(16,17)5-9(13)14/h2-4,12H,5H2,1H3,(H,13,14) |
| InChIKey | AWKVVAWZIHSPJM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |