C11H12FNO6S — CID 43716819
3-[(5-fluoro-2-methoxycarbonylphenyl)sulfamoyl]propanoic acid (PubChem CID 43716819) has the molecular formula C11H12FNO6S and a molecular weight of 305.28 g/mol. Its IUPAC name is 3-[(5-fluoro-2-methoxycarbonylphenyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(5-fluoro-2-methoxycarbonylphenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43716819 |
| Molecular Formula | C11H12FNO6S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[(5-fluoro-2-methoxycarbonylphenyl)sulfamoyl]propanoic acid |
| SMILES | COC(=O)c1ccc(F)cc1NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H12FNO6S/c1-19-11(16)8-3-2-7(12)6-9(8)13-20(17,18)5-4-10(14)15/h2-3,6,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | QZBDTJHHZWGSII-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |