C12H12BrF2NO2 — CID 113258550
(E)-3-(4-bromophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide (PubChem CID 113258550) has the molecular formula C12H12BrF2NO2 and a molecular weight of 320.13 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 113258550 |
| Molecular Formula | C12H12BrF2NO2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NCC(O)C(F)F |
| InChI | InChI=1S/C12H12BrF2NO2/c13-9-4-1-8(2-5-9)3-6-11(18)16-7-10(17)12(14)15/h1-6,10,12,17H,7H2,(H,16,18)/b6-3+ |
| InChIKey | MMOJIXDUTCABJR-ZZXKWVIFSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|