C18H24N4O2 — CID 113258948
2-N-benzyl-3-nitro-2-N-propan-2-yl-6-N-propylpyridine-2,6-diamine (PubChem CID 113258948) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-N-benzyl-3-nitro-2-N-propan-2-yl-6-N-propylpyridine-2,6-diamine.
| Compound Name | 2-N-benzyl-3-nitro-2-N-propan-2-yl-6-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 113258948 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-N-benzyl-3-nitro-2-N-propan-2-yl-6-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1ccc([N+](=O)[O-])c(N(Cc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-4-12-19-17-11-10-16(22(23)24)18(20-17)21(14(2)3)13-15-8-6-5-7-9-15/h5-11,14H,4,12-13H2,1-3H3,(H,19,20) |
| InChIKey | MSOCSRQSWPNPHO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|