C10H14F3N5O2 — CID 80902169
6-hydrazinyl-3-nitro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 80902169) has the molecular formula C10H14F3N5O2 and a molecular weight of 293.25 g/mol. Its IUPAC name is 6-hydrazinyl-3-nitro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-3-nitro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 80902169 |
| Molecular Formula | C10H14F3N5O2 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-hydrazinyl-3-nitro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | CC(C)N(CC(F)(F)F)c1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14F3N5O2/c1-6(2)17(5-10(11,12)13)9-7(18(19)20)3-4-8(15-9)16-14/h3-4,6H,5,14H2,1-2H3,(H,15,16) |
| InChIKey | ZPQLZJZQROTSFB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|