C9H15N5O4S — CID 80929654
6-hydrazinyl-N-methyl-N-(2-methylsulfonylethyl)-3-nitropyridin-2-amine (PubChem CID 80929654) has the molecular formula C9H15N5O4S and a molecular weight of 289.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(2-methylsulfonylethyl)-3-nitropyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-(2-methylsulfonylethyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80929654 |
| Molecular Formula | C9H15N5O4S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(2-methylsulfonylethyl)-3-nitropyridin-2-amine |
| SMILES | CN(CCS(C)(=O)=O)c1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N5O4S/c1-13(5-6-19(2,17)18)9-7(14(15)16)3-4-8(11-9)12-10/h3-4H,5-6,10H2,1-2H3,(H,11,12) |
| InChIKey | PYWANYGFJAHYNF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|