C15H22BrNOS — CID 113259213
2-bromo-N-(2-ethyl-2-methylsulfanylbutyl)-5-methylbenzamide (PubChem CID 113259213) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-bromo-N-(2-ethyl-2-methylsulfanylbutyl)-5-methylbenzamide.
| Compound Name | 2-bromo-N-(2-ethyl-2-methylsulfanylbutyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 113259213 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-bromo-N-(2-ethyl-2-methylsulfanylbutyl)-5-methylbenzamide |
| SMILES | CCC(CC)(CNC(=O)c1cc(C)ccc1Br)SC |
| InChI | InChI=1S/C15H22BrNOS/c1-5-15(6-2,19-4)10-17-14(18)12-9-11(3)7-8-13(12)16/h7-9H,5-6,10H2,1-4H3,(H,17,18) |
| InChIKey | KNVPQQLCSVJDBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |