C14H19BrClNOS — CID 103709313
5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzamide (PubChem CID 103709313) has the molecular formula C14H19BrClNOS and a molecular weight of 364.74 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzamide |
|---|---|
| PubChem CID | 103709313 |
| Molecular Formula | C14H19BrClNOS |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)benzamide |
| SMILES | CCC(CC)(CNC(=O)c1cc(Br)ccc1Cl)SC |
| InChI | InChI=1S/C14H19BrClNOS/c1-4-14(5-2,19-3)9-17-13(18)11-8-10(15)6-7-12(11)16/h6-8H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | WCQCXWVAQXHZMO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |