C22H34O4 — CID 11325946
ethyl (Z,5R)-2-[(E)-4-methyl-7-oxohept-3-enyl]-8-oxo-5-prop-1-en-2-ylnon-2-enoate (PubChem CID 11325946) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethyl (Z,5R)-2-[(E)-4-methyl-7-oxohept-3-enyl]-8-oxo-5-prop-1-en-2-ylnon-2-enoate.
| Compound Name | ethyl (Z,5R)-2-[(E)-4-methyl-7-oxohept-3-enyl]-8-oxo-5-prop-1-en-2-ylnon-2-enoate |
|---|---|
| PubChem CID | 11325946 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | ethyl (Z,5R)-2-[(E)-4-methyl-7-oxohept-3-enyl]-8-oxo-5-prop-1-en-2-ylnon-2-enoate |
| SMILES | C=C(C)[C@@H](C/C=C(/CC/C=C(\C)CCC=O)C(=O)OCC)CCC(C)=O |
| InChI | InChI=1S/C22H34O4/c1-6-26-22(25)21(11-7-9-18(4)10-8-16-23)15-14-20(17(2)3)13-12-19(5)24/h9,15-16,20H,2,6-8,10-14H2,1,3-5H3/b18-9+,21-15-/t20-/m1/s1 |
| InChIKey | XTFLDCCMGIXTKE-RRZHUSPYSA-N |
| XLogP | 5.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|