C20H26O4 — CID 163057646
(Z)-5-(5-oxo-2H-furan-3-yl)-2-[2-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]ethyl]pent-2-enal (PubChem CID 163057646) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (Z)-5-(5-oxo-2H-furan-3-yl)-2-[2-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]ethyl]pent-2-enal.
| Compound Name | (Z)-5-(5-oxo-2H-furan-3-yl)-2-[2-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]ethyl]pent-2-enal |
|---|---|
| PubChem CID | 163057646 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (Z)-5-(5-oxo-2H-furan-3-yl)-2-[2-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]ethyl]pent-2-enal |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@H]1CC/C(C=O)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C20H26O4/c1-14-9-17(22)11-20(2,3)18(14)8-7-15(12-21)5-4-6-16-10-19(23)24-13-16/h5,9-10,12,18H,4,6-8,11,13H2,1-3H3/b15-5-/t18-/m1/s1 |
| InChIKey | YVONBTHGNOQAFF-ZPZLLIBOSA-N |
| XLogP | 3.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|