C14H23NO2S — CID 113261259
3-[2-[1-(2-methoxyphenyl)ethylamino]ethylsulfanyl]propan-1-ol (PubChem CID 113261259) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 3-[2-[1-(2-methoxyphenyl)ethylamino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[1-(2-methoxyphenyl)ethylamino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 113261259 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[2-[1-(2-methoxyphenyl)ethylamino]ethylsulfanyl]propan-1-ol |
| SMILES | COc1ccccc1C(C)NCCSCCCO |
| InChI | InChI=1S/C14H23NO2S/c1-12(15-8-11-18-10-5-9-16)13-6-3-4-7-14(13)17-2/h3-4,6-7,12,15-16H,5,8-11H2,1-2H3 |
| InChIKey | WHTXQMUTIVZNJY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|