C13H19F2NO2 — CID 106840787
4-[1-[2-(difluoromethoxy)phenyl]ethylamino]butan-1-ol (PubChem CID 106840787) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-[1-[2-(difluoromethoxy)phenyl]ethylamino]butan-1-ol.
| Compound Name | 4-[1-[2-(difluoromethoxy)phenyl]ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 106840787 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[1-[2-(difluoromethoxy)phenyl]ethylamino]butan-1-ol |
| SMILES | CC(NCCCCO)c1ccccc1OC(F)F |
| InChI | InChI=1S/C13H19F2NO2/c1-10(16-8-4-5-9-17)11-6-2-3-7-12(11)18-13(14)15/h2-3,6-7,10,13,16-17H,4-5,8-9H2,1H3 |
| InChIKey | DYVJIKUDQPQBIY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|