C14H21F2NOS — CID 115721477
N-[1-[2-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115721477) has the molecular formula C14H21F2NOS and a molecular weight of 289.39 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115721477 |
| Molecular Formula | C14H21F2NOS |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCNC(C)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H21F2NOS/c1-11(17-9-5-6-10-19-2)12-7-3-4-8-13(12)18-14(15)16/h3-4,7-8,11,14,17H,5-6,9-10H2,1-2H3 |
| InChIKey | HJOFGMMFHVIJDI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|