C18H20ClN7 — CID 11326156
4-N-(3-chlorophenyl)-6-N-[2-(dimethylamino)ethyldiazenyl]quinazoline-4,6-diamine (PubChem CID 11326156) has the molecular formula C18H20ClN7 and a molecular weight of 369.86 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-6-N-[2-(dimethylamino)ethyldiazenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-6-N-[2-(dimethylamino)ethyldiazenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 11326156 |
| Molecular Formula | C18H20ClN7 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-N-(3-chlorophenyl)-6-N-[2-(dimethylamino)ethyldiazenyl]quinazoline-4,6-diamine |
| SMILES | CN(C)CC/N=N/Nc1ccc2ncnc(Nc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H20ClN7/c1-26(2)9-8-22-25-24-15-6-7-17-16(11-15)18(21-12-20-17)23-14-5-3-4-13(19)10-14/h3-7,10-12H,8-9H2,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | GOVBHWZRXMKGIA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|