C12H23N3OS — CID 113261870
1-[1-(1-ethylpyrazol-4-yl)ethylamino]-2-methyl-3-methylsulfanylpropan-2-ol (PubChem CID 113261870) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-[1-(1-ethylpyrazol-4-yl)ethylamino]-2-methyl-3-methylsulfanylpropan-2-ol.
| Compound Name | 1-[1-(1-ethylpyrazol-4-yl)ethylamino]-2-methyl-3-methylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 113261870 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-[1-(1-ethylpyrazol-4-yl)ethylamino]-2-methyl-3-methylsulfanylpropan-2-ol |
| SMILES | CCn1cc(C(C)NCC(C)(O)CSC)cn1 |
| InChI | InChI=1S/C12H23N3OS/c1-5-15-7-11(6-14-15)10(2)13-8-12(3,16)9-17-4/h6-7,10,13,16H,5,8-9H2,1-4H3 |
| InChIKey | RHQSFGAQTCUSRX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |