C12H20N6 — CID 164632644
(1S)-1-(1-ethylpyrazol-4-yl)-N-[(2-ethyltriazol-4-yl)methyl]ethanamine (PubChem CID 164632644) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is (1S)-1-(1-ethylpyrazol-4-yl)-N-[(2-ethyltriazol-4-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-ethylpyrazol-4-yl)-N-[(2-ethyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 164632644 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (1S)-1-(1-ethylpyrazol-4-yl)-N-[(2-ethyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCn1cc([C@H](C)NCc2cnn(CC)n2)cn1 |
| InChI | InChI=1S/C12H20N6/c1-4-17-9-11(6-14-17)10(3)13-7-12-8-15-18(5-2)16-12/h6,8-10,13H,4-5,7H2,1-3H3/t10-/m0/s1 |
| InChIKey | YRKRIZGXBKKWEL-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |