C15H20FN — CID 113262082
N-[1-(3-fluorophenyl)propan-2-yl]hex-5-yn-3-amine (PubChem CID 113262082) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)propan-2-yl]hex-5-yn-3-amine.
| Compound Name | N-[1-(3-fluorophenyl)propan-2-yl]hex-5-yn-3-amine |
|---|---|
| PubChem CID | 113262082 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-[1-(3-fluorophenyl)propan-2-yl]hex-5-yn-3-amine |
| SMILES | C#CCC(CC)NC(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FN/c1-4-7-15(5-2)17-12(3)10-13-8-6-9-14(16)11-13/h1,6,8-9,11-12,15,17H,5,7,10H2,2-3H3 |
| InChIKey | BRMKXPJILZOMLI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|