C12H15BrFNO2 — CID 113264397
3-bromo-5-fluoro-N-(4-hydroxy-3-methylbutan-2-yl)benzamide (PubChem CID 113264397) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N-(4-hydroxy-3-methylbutan-2-yl)benzamide.
| Compound Name | 3-bromo-5-fluoro-N-(4-hydroxy-3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113264397 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-bromo-5-fluoro-N-(4-hydroxy-3-methylbutan-2-yl)benzamide |
| SMILES | CC(CO)C(C)NC(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C12H15BrFNO2/c1-7(6-16)8(2)15-12(17)9-3-10(13)5-11(14)4-9/h3-5,7-8,16H,6H2,1-2H3,(H,15,17) |
| InChIKey | HXFQTZKBDCXAMP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |