C12H17F3N2S — CID 113268493
N-(4-ethylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 113268493) has the molecular formula C12H17F3N2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 113268493 |
| Molecular Formula | C12H17F3N2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCSCCC(C)Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N2S/c1-3-18-8-7-9(2)16-11-6-4-5-10(17-11)12(13,14)15/h4-6,9H,3,7-8H2,1-2H3,(H,16,17) |
| InChIKey | AHABHOMNEGCSFP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|