C9H11F3N2O2 — CID 65314262
2-[[6-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol (PubChem CID 65314262) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 2-[[6-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol.
| Compound Name | 2-[[6-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65314262 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[[6-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol |
| SMILES | OCC(CO)Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O2/c10-9(11,12)7-2-1-3-8(14-7)13-6(4-15)5-16/h1-3,6,15-16H,4-5H2,(H,13,14) |
| InChIKey | YRKXSEGINNIPMX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |