C13H26N2O2 — CID 113270028
2-(aminomethyl)-N,2-dimethyl-N-(oxan-2-ylmethyl)butanamide (PubChem CID 113270028) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N,2-dimethyl-N-(oxan-2-ylmethyl)butanamide.
| Compound Name | 2-(aminomethyl)-N,2-dimethyl-N-(oxan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 113270028 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-(aminomethyl)-N,2-dimethyl-N-(oxan-2-ylmethyl)butanamide |
| SMILES | CCC(C)(CN)C(=O)N(C)CC1CCCCO1 |
| InChI | InChI=1S/C13H26N2O2/c1-4-13(2,10-14)12(16)15(3)9-11-7-5-6-8-17-11/h11H,4-10,14H2,1-3H3 |
| InChIKey | WFTAEYQCERGSDF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |