C11H21NO3 — CID 131997483
N-hydroxy-2,2-dimethyl-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 131997483) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | N-hydroxy-2,2-dimethyl-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 131997483 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | CCC(C)(C)C(=O)N(O)CC1CCCO1 |
| InChI | InChI=1S/C11H21NO3/c1-4-11(2,3)10(13)12(14)8-9-6-5-7-15-9/h9,14H,4-8H2,1-3H3 |
| InChIKey | XHPWKWDPSGIBMH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|