C15H26ClNO3 — CID 63666515
3-chloro-2,2-dimethyl-N,N-bis(oxolan-2-ylmethyl)propanamide (PubChem CID 63666515) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N,N-bis(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N,N-bis(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 63666515 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N,N-bis(oxolan-2-ylmethyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)N(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C15H26ClNO3/c1-15(2,11-16)14(18)17(9-12-5-3-7-19-12)10-13-6-4-8-20-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | AMINMSMGHJHJJG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|