C12H22ClNO — CID 107397616
3-chloro-N-(cyclobutylmethyl)-N-ethyl-2,2-dimethylpropanamide (PubChem CID 107397616) has the molecular formula C12H22ClNO and a molecular weight of 231.77 g/mol. Its IUPAC name is 3-chloro-N-(cyclobutylmethyl)-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(cyclobutylmethyl)-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 107397616 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-chloro-N-(cyclobutylmethyl)-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCN(CC1CCC1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H22ClNO/c1-4-14(8-10-6-5-7-10)11(15)12(2,3)9-13/h10H,4-9H2,1-3H3 |
| InChIKey | GOMZIKKXFCTWJS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|