C10H14F5NO — CID 114038274
N-(cyclobutylmethyl)-N-ethyl-2,2,3,3,3-pentafluoropropanamide (PubChem CID 114038274) has the molecular formula C10H14F5NO and a molecular weight of 259.22 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-ethyl-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(cyclobutylmethyl)-N-ethyl-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 114038274 |
| Molecular Formula | C10H14F5NO |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(cyclobutylmethyl)-N-ethyl-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCN(CC1CCC1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO/c1-2-16(6-7-4-3-5-7)8(17)9(11,12)10(13,14)15/h7H,2-6H2,1H3 |
| InChIKey | AQQHQXWDONKLSX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|