2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate

C10H19NO3 — CID 107402491

IUPAC2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate
SMILESCCN(CC1CCC1)C(=O)OCCO
InChIInChI=1S/C10H19NO3/c1-2-11(8-9-4-3-5-9)10(13)14-7-6-12/h9,12H,2-8H2,1H3
InChIKeySMZBNCNOYGGISN-UHFFFAOYSA-N
MW201.27 g/mol
LogP1.24
Rot. Bonds5

About 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate

2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate (PubChem CID 107402491) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate.

Molecular Properties

Compound Name2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate
PubChem CID107402491
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate
SMILESCCN(CC1CCC1)C(=O)OCCO
InChIInChI=1S/C10H19NO3/c1-2-11(8-9-4-3-5-9)10(13)14-7-6-12/h9,12H,2-8H2,1H3
InChIKeySMZBNCNOYGGISN-UHFFFAOYSA-N
XLogP1.24
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The IUPAC name of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate (CID 107402491) is 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate is CCN(CC1CCC1)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The InChIKey is SMZBNCNOYGGISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-11(8-9-4-3-5-9)10(13)14-7-6-12/h9,12H,2-8H2,1H3.
What are the key properties of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate has a molecular weight of 201.27 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate is sourced from PubChem (CID 107402491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).