About 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate
2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate (PubChem CID 107402491) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate |
| PubChem CID | 107402491 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate |
| SMILES | CCN(CC1CCC1)C(=O)OCCO |
| InChI | InChI=1S/C10H19NO3/c1-2-11(8-9-4-3-5-9)10(13)14-7-6-12/h9,12H,2-8H2,1H3 |
| InChIKey | SMZBNCNOYGGISN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The IUPAC name of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate (CID 107402491) is 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate is CCN(CC1CCC1)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
The InChIKey is SMZBNCNOYGGISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-11(8-9-4-3-5-9)10(13)14-7-6-12/h9,12H,2-8H2,1H3.
What are the key properties of 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate?
2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate has a molecular weight of 201.27 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-(cyclobutylmethyl)-N-ethylcarbamate is sourced from PubChem (CID 107402491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).