C12H23NO2 — CID 131997480
N-(cyclopentylmethyl)-N-hydroxy-2,2-dimethylbutanamide (PubChem CID 131997480) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-N-hydroxy-2,2-dimethylbutanamide.
| Compound Name | N-(cyclopentylmethyl)-N-hydroxy-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 131997480 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(cyclopentylmethyl)-N-hydroxy-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(O)CC1CCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-4-12(2,3)11(14)13(15)9-10-7-5-6-8-10/h10,15H,4-9H2,1-3H3 |
| InChIKey | FZINJMLFZMMHQM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|