C13H21BrN2O2S — CID 113271109
N-[3-(bromomethyl)pentan-3-yl]-2-pyridin-4-ylethanesulfonamide (PubChem CID 113271109) has the molecular formula C13H21BrN2O2S and a molecular weight of 349.29 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-2-pyridin-4-ylethanesulfonamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-2-pyridin-4-ylethanesulfonamide |
|---|---|
| PubChem CID | 113271109 |
| Molecular Formula | C13H21BrN2O2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-2-pyridin-4-ylethanesulfonamide |
| SMILES | CCC(CC)(CBr)NS(=O)(=O)CCc1ccncc1 |
| InChI | InChI=1S/C13H21BrN2O2S/c1-3-13(4-2,11-14)16-19(17,18)10-7-12-5-8-15-9-6-12/h5-6,8-9,16H,3-4,7,10-11H2,1-2H3 |
| InChIKey | FWVBYZCONDLDJK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|