C13H20N2O4S — CID 79806634
2-ethyl-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid (PubChem CID 79806634) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-ethyl-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid.
| Compound Name | 2-ethyl-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 79806634 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-ethyl-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid |
| SMILES | CCC(CC)(NS(=O)(=O)CCc1ccncc1)C(=O)O |
| InChI | InChI=1S/C13H20N2O4S/c1-3-13(4-2,12(16)17)15-20(18,19)10-7-11-5-8-14-9-6-11/h5-6,8-9,15H,3-4,7,10H2,1-2H3,(H,16,17) |
| InChIKey | YEKJGHWMZGUJRP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |