C19H28BrNO4 — CID 11327443
ethyl (2S)-2-[3-bromopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate (PubChem CID 11327443) has the molecular formula C19H28BrNO4 and a molecular weight of 414.34 g/mol. Its IUPAC name is ethyl (2S)-2-[3-bromopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[3-bromopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11327443 |
| Molecular Formula | C19H28BrNO4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | ethyl (2S)-2-[3-bromopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)N(CCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28BrNO4/c1-5-24-17(22)16(14-15-10-7-6-8-11-15)21(13-9-12-20)18(23)25-19(2,3)4/h6-8,10-11,16H,5,9,12-14H2,1-4H3/t16-/m0/s1 |
| InChIKey | UAPGKKOIQCGTCJ-INIZCTEOSA-N |
| XLogP | 4.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|