C23H34FN3O3 — CID 11327594
(3R)-3-(cyclohexylmethyl)-N-[2-(4-fluoroanilino)ethyl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 11327594) has the molecular formula C23H34FN3O3 and a molecular weight of 419.54 g/mol. Its IUPAC name is (3R)-3-(cyclohexylmethyl)-N-[2-(4-fluoroanilino)ethyl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | (3R)-3-(cyclohexylmethyl)-N-[2-(4-fluoroanilino)ethyl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 11327594 |
| Molecular Formula | C23H34FN3O3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (3R)-3-(cyclohexylmethyl)-N-[2-(4-fluoroanilino)ethyl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | O=C(C[C@@H](CC1CCCCC1)C(=O)N1CCOCC1)NCCNc1ccc(F)cc1 |
| InChI | InChI=1S/C23H34FN3O3/c24-20-6-8-21(9-7-20)25-10-11-26-22(28)17-19(16-18-4-2-1-3-5-18)23(29)27-12-14-30-15-13-27/h6-9,18-19,25H,1-5,10-17H2,(H,26,28)/t19-/m1/s1 |
| InChIKey | GBWWFYPYZLWCDD-LJQANCHMSA-N |
| XLogP | 3.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|