C15H20BrClO — CID 113276992
2-(bromomethyl)-1-chloro-3-(2-ethylcyclohexyl)oxybenzene (PubChem CID 113276992) has the molecular formula C15H20BrClO and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-(bromomethyl)-1-chloro-3-(2-ethylcyclohexyl)oxybenzene.
| Compound Name | 2-(bromomethyl)-1-chloro-3-(2-ethylcyclohexyl)oxybenzene |
|---|---|
| PubChem CID | 113276992 |
| Molecular Formula | C15H20BrClO |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(bromomethyl)-1-chloro-3-(2-ethylcyclohexyl)oxybenzene |
| SMILES | CCC1CCCCC1Oc1cccc(Cl)c1CBr |
| InChI | InChI=1S/C15H20BrClO/c1-2-11-6-3-4-8-14(11)18-15-9-5-7-13(17)12(15)10-16/h5,7,9,11,14H,2-4,6,8,10H2,1H3 |
| InChIKey | KDBSQSYOICOSQE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|