C14H22N2O3S — CID 115992999
2-amino-3-(2-ethylcyclohexyl)oxybenzenesulfonamide (PubChem CID 115992999) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-amino-3-(2-ethylcyclohexyl)oxybenzenesulfonamide.
| Compound Name | 2-amino-3-(2-ethylcyclohexyl)oxybenzenesulfonamide |
|---|---|
| PubChem CID | 115992999 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-amino-3-(2-ethylcyclohexyl)oxybenzenesulfonamide |
| SMILES | CCC1CCCCC1Oc1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C14H22N2O3S/c1-2-10-6-3-4-7-11(10)19-12-8-5-9-13(14(12)15)20(16,17)18/h5,8-11H,2-4,6-7,15H2,1H3,(H2,16,17,18) |
| InChIKey | OVPFOFHXQRRPOC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|