C13H17BrClNO — CID 113277161
1-[2-(2-bromoprop-2-enoxy)-6-chlorophenyl]butan-2-amine (PubChem CID 113277161) has the molecular formula C13H17BrClNO and a molecular weight of 318.64 g/mol. Its IUPAC name is 1-[2-(2-bromoprop-2-enoxy)-6-chlorophenyl]butan-2-amine.
| Compound Name | 1-[2-(2-bromoprop-2-enoxy)-6-chlorophenyl]butan-2-amine |
|---|---|
| PubChem CID | 113277161 |
| Molecular Formula | C13H17BrClNO |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-[2-(2-bromoprop-2-enoxy)-6-chlorophenyl]butan-2-amine |
| SMILES | C=C(Br)COc1cccc(Cl)c1CC(N)CC |
| InChI | InChI=1S/C13H17BrClNO/c1-3-10(16)7-11-12(15)5-4-6-13(11)17-8-9(2)14/h4-6,10H,2-3,7-8,16H2,1H3 |
| InChIKey | WWLUPCDXZGSBHH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |