C17H26ClNO — CID 114322036
1-[2-chloro-6-(cyclohexylmethoxy)phenyl]butan-2-amine (PubChem CID 114322036) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is 1-[2-chloro-6-(cyclohexylmethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[2-chloro-6-(cyclohexylmethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 114322036 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[2-chloro-6-(cyclohexylmethoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1c(Cl)cccc1OCC1CCCCC1 |
| InChI | InChI=1S/C17H26ClNO/c1-2-14(19)11-15-16(18)9-6-10-17(15)20-12-13-7-4-3-5-8-13/h6,9-10,13-14H,2-5,7-8,11-12,19H2,1H3 |
| InChIKey | AYNOSDNKTJYYBJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |