C26H24N4O2 — CID 11327727
4-[[4-amino-2-(3-methoxyphenyl)phenyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile (PubChem CID 11327727) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[[4-amino-2-(3-methoxyphenyl)phenyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile.
| Compound Name | 4-[[4-amino-2-(3-methoxyphenyl)phenyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 11327727 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-[[4-amino-2-(3-methoxyphenyl)phenyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile |
| SMILES | COc1cccc(-c2cc(N)ccc2COC(c2ccc(C#N)cc2)c2cncn2C)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-30-17-29-15-25(30)26(19-8-6-18(14-27)7-9-19)32-16-21-10-11-22(28)13-24(21)20-4-3-5-23(12-20)31-2/h3-13,15,17,26H,16,28H2,1-2H3 |
| InChIKey | NVTDTBWAXYAWGW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|