C12H10BrClN2OS — CID 113277395
2-[(4-bromothiophen-2-yl)methoxy]-6-chlorobenzenecarboximidamide (PubChem CID 113277395) has the molecular formula C12H10BrClN2OS and a molecular weight of 345.65 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methoxy]-6-chlorobenzenecarboximidamide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methoxy]-6-chlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 113277395 |
| Molecular Formula | C12H10BrClN2OS |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methoxy]-6-chlorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H10BrClN2OS/c13-7-4-8(18-6-7)5-17-10-3-1-2-9(14)11(10)12(15)16/h1-4,6H,5H2,(H3,15,16) |
| InChIKey | USKSCMLZXIQVLJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|