C13H16ClN5O — CID 114323489
2-chloro-6-[(2-propan-2-yl-1,2,4-triazol-3-yl)methoxy]benzenecarboximidamide (PubChem CID 114323489) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 2-chloro-6-[(2-propan-2-yl-1,2,4-triazol-3-yl)methoxy]benzenecarboximidamide.
| Compound Name | 2-chloro-6-[(2-propan-2-yl-1,2,4-triazol-3-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 114323489 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-chloro-6-[(2-propan-2-yl-1,2,4-triazol-3-yl)methoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1OCc1ncnn1C(C)C |
| InChI | InChI=1S/C13H16ClN5O/c1-8(2)19-11(17-7-18-19)6-20-10-5-3-4-9(14)12(10)13(15)16/h3-5,7-8H,6H2,1-2H3,(H3,15,16) |
| InChIKey | QUALNAXOPWJUKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|