C11H16N2O4 — CID 113278446
N-(2-hydroxy-3-methoxypropyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 113278446) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113278446 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | COCC(O)CNC(=O)c1c[nH]c(C)cc1=O |
| InChI | InChI=1S/C11H16N2O4/c1-7-3-10(15)9(5-12-7)11(16)13-4-8(14)6-17-2/h3,5,8,14H,4,6H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | HWYKEJIZBONEJT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |