C13H18N4S — CID 113278965
(4-cyclohexyl-1,2,4-triazol-3-yl)-thiophen-2-ylmethanamine (PubChem CID 113278965) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is (4-cyclohexyl-1,2,4-triazol-3-yl)-thiophen-2-ylmethanamine.
| Compound Name | (4-cyclohexyl-1,2,4-triazol-3-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 113278965 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (4-cyclohexyl-1,2,4-triazol-3-yl)-thiophen-2-ylmethanamine |
| SMILES | NC(c1cccs1)c1nncn1C1CCCCC1 |
| InChI | InChI=1S/C13H18N4S/c14-12(11-7-4-8-18-11)13-16-15-9-17(13)10-5-2-1-3-6-10/h4,7-10,12H,1-3,5-6,14H2 |
| InChIKey | JVZOTHUGRBOAGT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |