C9H13N3O6S — CID 113279548
2-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 113279548) has the molecular formula C9H13N3O6S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 113279548 |
| Molecular Formula | C9H13N3O6S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | COC(=O)CS(=O)(=O)NC(C(=O)O)c1cnn(C)c1 |
| InChI | InChI=1S/C9H13N3O6S/c1-12-4-6(3-10-12)8(9(14)15)11-19(16,17)5-7(13)18-2/h3-4,8,11H,5H2,1-2H3,(H,14,15) |
| InChIKey | BOOBMPWXDJJEFN-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |