C11H19N3O2 — CID 61002889
methyl 2-(2-methylpropylamino)-2-(1-methylpyrazol-4-yl)acetate (PubChem CID 61002889) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl 2-(2-methylpropylamino)-2-(1-methylpyrazol-4-yl)acetate.
| Compound Name | methyl 2-(2-methylpropylamino)-2-(1-methylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 61002889 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | methyl 2-(2-methylpropylamino)-2-(1-methylpyrazol-4-yl)acetate |
| SMILES | COC(=O)C(NCC(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C11H19N3O2/c1-8(2)5-12-10(11(15)16-4)9-6-13-14(3)7-9/h6-8,10,12H,5H2,1-4H3 |
| InChIKey | VMANKUBQTDDDCH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |