C14H25NO3 — CID 113280395
(3,4-dimethylcyclohexyl) 4-aminooxane-4-carboxylate (PubChem CID 113280395) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl) 4-aminooxane-4-carboxylate.
| Compound Name | (3,4-dimethylcyclohexyl) 4-aminooxane-4-carboxylate |
|---|---|
| PubChem CID | 113280395 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (3,4-dimethylcyclohexyl) 4-aminooxane-4-carboxylate |
| SMILES | CC1CCC(OC(=O)C2(N)CCOCC2)CC1C |
| InChI | InChI=1S/C14H25NO3/c1-10-3-4-12(9-11(10)2)18-13(16)14(15)5-7-17-8-6-14/h10-12H,3-9,15H2,1-2H3 |
| InChIKey | UVVGHRKCMLCQAD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |