C23H23FN4O4 — CID 11328073
4-(4-fluoro-3-methoxyanilino)-8-methyl-6-(morpholine-4-carbonyl)quinoline-3-carboxamide (PubChem CID 11328073) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 4-(4-fluoro-3-methoxyanilino)-8-methyl-6-(morpholine-4-carbonyl)quinoline-3-carboxamide.
| Compound Name | 4-(4-fluoro-3-methoxyanilino)-8-methyl-6-(morpholine-4-carbonyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 11328073 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-(4-fluoro-3-methoxyanilino)-8-methyl-6-(morpholine-4-carbonyl)quinoline-3-carboxamide |
| SMILES | COc1cc(Nc2c(C(N)=O)cnc3c(C)cc(C(=O)N4CCOCC4)cc23)ccc1F |
| InChI | InChI=1S/C23H23FN4O4/c1-13-9-14(23(30)28-5-7-32-8-6-28)10-16-20(13)26-12-17(22(25)29)21(16)27-15-3-4-18(24)19(11-15)31-2/h3-4,9-12H,5-8H2,1-2H3,(H2,25,29)(H,26,27) |
| InChIKey | XSKPNFHGYMZXRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |