C14H22BrN3 — CID 113281289
4-bromo-3-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline (PubChem CID 113281289) has the molecular formula C14H22BrN3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 4-bromo-3-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline.
| Compound Name | 4-bromo-3-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 113281289 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-bromo-3-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline |
| SMILES | CC(C)N1CCN(Cc2cc(N)ccc2Br)CC1 |
| InChI | InChI=1S/C14H22BrN3/c1-11(2)18-7-5-17(6-8-18)10-12-9-13(16)3-4-14(12)15/h3-4,9,11H,5-8,10,16H2,1-2H3 |
| InChIKey | WGOKZSXLNBTQSB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|