C14H22FN3 — CID 64770609
3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline (PubChem CID 64770609) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline.
| Compound Name | 3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 64770609 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]aniline |
| SMILES | CC(C)N1CCN(Cc2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C14H22FN3/c1-11(2)18-7-5-17(6-8-18)10-12-3-4-13(16)9-14(12)15/h3-4,9,11H,5-8,10,16H2,1-2H3 |
| InChIKey | IMDHYHSUGRIJEX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|