C12H15FN2O2S — CID 113281569
N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-5-fluoro-2-hydroxybenzamide (PubChem CID 113281569) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 113281569 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-5-fluoro-2-hydroxybenzamide |
| SMILES | CCN(CCC(N)=S)C(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C12H15FN2O2S/c1-2-15(6-5-11(14)18)12(17)9-7-8(13)3-4-10(9)16/h3-4,7,16H,2,5-6H2,1H3,(H2,14,18) |
| InChIKey | GZEMGOQVWJXLQE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|