C13H16F2N2OS — CID 82815244
N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2,6-difluoro-3-methylbenzamide (PubChem CID 82815244) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82815244 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2,6-difluoro-3-methylbenzamide |
| SMILES | CCN(CCC(N)=S)C(=O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C13H16F2N2OS/c1-3-17(7-6-10(16)19)13(18)11-9(14)5-4-8(2)12(11)15/h4-5H,3,6-7H2,1-2H3,(H2,16,19) |
| InChIKey | NOVMQPWNJSFDLY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|